C20H30N4O4S — CID 27181136
N-(prop-2-enylcarbamoyl)-2-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 27181136) has the molecular formula C20H30N4O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-(prop-2-enylcarbamoyl)-2-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(prop-2-enylcarbamoyl)-2-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 27181136 |
| Molecular Formula | C20H30N4O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-(prop-2-enylcarbamoyl)-2-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | C=CCNC(=O)NC(=O)CN1CCN(S(=O)(=O)c2c(C)c(C)cc(C)c2C)CC1 |
| InChI | InChI=1S/C20H30N4O4S/c1-6-7-21-20(26)22-18(25)13-23-8-10-24(11-9-23)29(27,28)19-16(4)14(2)12-15(3)17(19)5/h6,12H,1,7-11,13H2,2-5H3,(H2,21,22,25,26) |
| InChIKey | QUWVJFWOVDLPOP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|