C15H24N2O3 — CID 115371337
methyl (2R)-1-[2-[cyclopenten-1-yl(methyl)amino]-2-oxoethyl]piperidine-2-carboxylate (PubChem CID 115371337) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is methyl (2R)-1-[2-[cyclopenten-1-yl(methyl)amino]-2-oxoethyl]piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[2-[cyclopenten-1-yl(methyl)amino]-2-oxoethyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115371337 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | methyl (2R)-1-[2-[cyclopenten-1-yl(methyl)amino]-2-oxoethyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1CC(=O)N(C)C1=CCCC1 |
| InChI | InChI=1S/C15H24N2O3/c1-16(12-7-3-4-8-12)14(18)11-17-10-6-5-9-13(17)15(19)20-2/h7,13H,3-6,8-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | GAFGVNVGAUDLQM-CYBMUJFWSA-N |
| XLogP | 1.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |