C16H26N2O3 — CID 80718028
methyl 2-[[2-[cyclopenten-1-yl(methyl)amino]-2-oxoethyl]-cyclopentylamino]acetate (PubChem CID 80718028) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 2-[[2-[cyclopenten-1-yl(methyl)amino]-2-oxoethyl]-cyclopentylamino]acetate.
| Compound Name | methyl 2-[[2-[cyclopenten-1-yl(methyl)amino]-2-oxoethyl]-cyclopentylamino]acetate |
|---|---|
| PubChem CID | 80718028 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | methyl 2-[[2-[cyclopenten-1-yl(methyl)amino]-2-oxoethyl]-cyclopentylamino]acetate |
| SMILES | COC(=O)CN(CC(=O)N(C)C1=CCCC1)C1CCCC1 |
| InChI | InChI=1S/C16H26N2O3/c1-17(13-7-3-4-8-13)15(19)11-18(12-16(20)21-2)14-9-5-6-10-14/h7,14H,3-6,8-12H2,1-2H3 |
| InChIKey | GDEKLWHBCRHQLO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |