C14H12FN3O2S — CID 115371692
2-[(6-fluoro-3-pyridinyl)oxymethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 115371692) has the molecular formula C14H12FN3O2S and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[(6-fluoro-3-pyridinyl)oxymethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(6-fluoro-3-pyridinyl)oxymethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 115371692 |
| Molecular Formula | C14H12FN3O2S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[(6-fluoro-3-pyridinyl)oxymethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(COc3ccc(F)nc3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C14H12FN3O2S/c1-7-8(2)21-14-12(7)13(19)17-11(18-14)6-20-9-3-4-10(15)16-5-9/h3-5H,6H2,1-2H3,(H,17,18,19) |
| InChIKey | GVZIZRNUFGHRQF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|