C14H14N4S — CID 115372397
N-(2-phenylsulfanylethyl)pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 115372397) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-(2-phenylsulfanylethyl)pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 115372397 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(2-phenylsulfanylethyl)pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | c1ccc(SCCNc2ccn3nccc3n2)cc1 |
| InChI | InChI=1S/C14H14N4S/c1-2-4-12(5-3-1)19-11-9-15-13-7-10-18-14(17-13)6-8-16-18/h1-8,10H,9,11H2,(H,15,17) |
| InChIKey | DUGPDYXFNNVORG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|