C15H16N4 — CID 115372598
N-[(2-ethylphenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 115372598) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is N-[(2-ethylphenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[(2-ethylphenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 115372598 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-[(2-ethylphenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CCc1ccccc1CNc1ccn2nccc2n1 |
| InChI | InChI=1S/C15H16N4/c1-2-12-5-3-4-6-13(12)11-16-14-8-10-19-15(18-14)7-9-17-19/h3-10H,2,11H2,1H3,(H,16,18) |
| InChIKey | YZKGAVZDTDRDFZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |