About N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine
N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 115372482) has the molecular formula C13H10F2N4
and a molecular weight of 260.25 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine |
| PubChem CID | 115372482 |
| Molecular Formula | C13H10F2N4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Fc1ccc(CNc2ccn3nccc3n2)cc1F |
| InChI | InChI=1S/C13H10F2N4/c14-10-2-1-9(7-11(10)15)8-16-12-4-6-19-13(18-12)3-5-17-19/h1-7H,8H2,(H,16,18) |
| InChIKey | FRZNCYBGDDBFPX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine?
The IUPAC name of N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine (CID 115372482) is N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine.
What is the SMILES notation for N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine?
The canonical SMILES for N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine is Fc1ccc(CNc2ccn3nccc3n2)cc1F.
What is the InChIKey of N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine?
The InChIKey is FRZNCYBGDDBFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2N4/c14-10-2-1-9(7-11(10)15)8-16-12-4-6-19-13(18-12)3-5-17-19/h1-7H,8H2,(H,16,18).
What are the key properties of N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine?
N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine has a molecular weight of 260.25 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-difluorophenyl)methyl]pyrazolo[1,5-a]pyrimidin-5-amine is sourced from PubChem (CID 115372482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).