C15H14Cl2N4 — CID 115378675
5,6-dichloro-1-[3-(dimethylamino)phenyl]benzimidazol-2-amine (PubChem CID 115378675) has the molecular formula C15H14Cl2N4 and a molecular weight of 321.21 g/mol. Its IUPAC name is 5,6-dichloro-1-[3-(dimethylamino)phenyl]benzimidazol-2-amine.
| Compound Name | 5,6-dichloro-1-[3-(dimethylamino)phenyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 115378675 |
| Molecular Formula | C15H14Cl2N4 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5,6-dichloro-1-[3-(dimethylamino)phenyl]benzimidazol-2-amine |
| SMILES | CN(C)c1cccc(-n2c(N)nc3cc(Cl)c(Cl)cc32)c1 |
| InChI | InChI=1S/C15H14Cl2N4/c1-20(2)9-4-3-5-10(6-9)21-14-8-12(17)11(16)7-13(14)19-15(21)18/h3-8H,1-2H3,(H2,18,19) |
| InChIKey | FAOHSVIMJKHCOE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |