C19H21F3N2O3 — CID 11538186
[6-methyl-1-[2-oxo-4-(trifluoromethyl)-1H-quinolin-6-yl]piperidin-2-yl]methyl acetate (PubChem CID 11538186) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is [6-methyl-1-[2-oxo-4-(trifluoromethyl)-1H-quinolin-6-yl]piperidin-2-yl]methyl acetate.
| Compound Name | [6-methyl-1-[2-oxo-4-(trifluoromethyl)-1H-quinolin-6-yl]piperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11538186 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [6-methyl-1-[2-oxo-4-(trifluoromethyl)-1H-quinolin-6-yl]piperidin-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CCCC(C)N1c1ccc2[nH]c(=O)cc(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C19H21F3N2O3/c1-11-4-3-5-14(10-27-12(2)25)24(11)13-6-7-17-15(8-13)16(19(20,21)22)9-18(26)23-17/h6-9,11,14H,3-5,10H2,1-2H3,(H,23,26) |
| InChIKey | UPYIDJJKZIEQRA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |