C9H8FN3S3 — CID 115382797
3-fluoro-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline (PubChem CID 115382797) has the molecular formula C9H8FN3S3 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-fluoro-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline.
| Compound Name | 3-fluoro-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 115382797 |
| Molecular Formula | C9H8FN3S3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 3-fluoro-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]aniline |
| SMILES | CSc1nnc(Sc2cc(N)cc(F)c2)s1 |
| InChI | InChI=1S/C9H8FN3S3/c1-14-8-12-13-9(16-8)15-7-3-5(10)2-6(11)4-7/h2-4H,11H2,1H3 |
| InChIKey | WKNWDGXUDVRINO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|