C8H6FN3S2 — CID 60875576
3-fluoro-5-(1,3,4-thiadiazol-2-ylsulfanyl)aniline (PubChem CID 60875576) has the molecular formula C8H6FN3S2 and a molecular weight of 227.29 g/mol. Its IUPAC name is 3-fluoro-5-(1,3,4-thiadiazol-2-ylsulfanyl)aniline.
| Compound Name | 3-fluoro-5-(1,3,4-thiadiazol-2-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 60875576 |
| Molecular Formula | C8H6FN3S2 |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 3-fluoro-5-(1,3,4-thiadiazol-2-ylsulfanyl)aniline |
| SMILES | Nc1cc(F)cc(Sc2nncs2)c1 |
| InChI | InChI=1S/C8H6FN3S2/c9-5-1-6(10)3-7(2-5)14-8-12-11-4-13-8/h1-4H,10H2 |
| InChIKey | MNLVYKQBNGBERY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|