C11H17ClN2OS2 — CID 115384942
5-(3-chloropropyl)-3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazole (PubChem CID 115384942) has the molecular formula C11H17ClN2OS2 and a molecular weight of 292.86 g/mol. Its IUPAC name is 5-(3-chloropropyl)-3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(3-chloropropyl)-3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 115384942 |
| Molecular Formula | C11H17ClN2OS2 |
| Molecular Weight | 292.86 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5-(3-chloropropyl)-3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazole |
| SMILES | CCC1SCCSC1c1noc(CCCCl)n1 |
| InChI | InChI=1S/C11H17ClN2OS2/c1-2-8-10(17-7-6-16-8)11-13-9(15-14-11)4-3-5-12/h8,10H,2-7H2,1H3 |
| InChIKey | KIEVATPQWJBVEW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|