C14H17ClO2S2 — CID 115386042
(5-chloro-2-methoxyphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone (PubChem CID 115386042) has the molecular formula C14H17ClO2S2 and a molecular weight of 316.88 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone.
| Compound Name | (5-chloro-2-methoxyphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 115386042 |
| Molecular Formula | C14H17ClO2S2 |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-(3-ethyl-1,4-dithian-2-yl)methanone |
| SMILES | CCC1SCCSC1C(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C14H17ClO2S2/c1-3-12-14(19-7-6-18-12)13(16)10-8-9(15)4-5-11(10)17-2/h4-5,8,12,14H,3,6-7H2,1-2H3 |
| InChIKey | GSXNVBVLPSHEDL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |