C13H21N3S2 — CID 115388526
2-(3-ethyl-1,4-dithian-2-yl)-N,5,6-trimethylpyrimidin-4-amine (PubChem CID 115388526) has the molecular formula C13H21N3S2 and a molecular weight of 283.47 g/mol. Its IUPAC name is 2-(3-ethyl-1,4-dithian-2-yl)-N,5,6-trimethylpyrimidin-4-amine.
| Compound Name | 2-(3-ethyl-1,4-dithian-2-yl)-N,5,6-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115388526 |
| Molecular Formula | C13H21N3S2 |
| Molecular Weight | 283.47 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-(3-ethyl-1,4-dithian-2-yl)-N,5,6-trimethylpyrimidin-4-amine |
| SMILES | CCC1SCCSC1c1nc(C)c(C)c(NC)n1 |
| InChI | InChI=1S/C13H21N3S2/c1-5-10-11(18-7-6-17-10)13-15-9(3)8(2)12(14-4)16-13/h10-11H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | TVKHAALQQADEGQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |