C10H10FN3OS — CID 115389344
3-(2-fluoro-6-methoxyphenyl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 115389344) has the molecular formula C10H10FN3OS and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-(2-fluoro-6-methoxyphenyl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-fluoro-6-methoxyphenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115389344 |
| Molecular Formula | C10H10FN3OS |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 3-(2-fluoro-6-methoxyphenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cccc(F)c1-c1n[nH]c(=S)n1C |
| InChI | InChI=1S/C10H10FN3OS/c1-14-9(12-13-10(14)16)8-6(11)4-3-5-7(8)15-2/h3-5H,1-2H3,(H,13,16) |
| InChIKey | VSVJSEQAEFNZDG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|