C11H11F2N3OS — CID 115391300
3-(2,3-difluorophenyl)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 115391300) has the molecular formula C11H11F2N3OS and a molecular weight of 271.29 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,3-difluorophenyl)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115391300 |
| Molecular Formula | C11H11F2N3OS |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-(2,3-difluorophenyl)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COCCn1c(-c2cccc(F)c2F)n[nH]c1=S |
| InChI | InChI=1S/C11H11F2N3OS/c1-17-6-5-16-10(14-15-11(16)18)7-3-2-4-8(12)9(7)13/h2-4H,5-6H2,1H3,(H,15,18) |
| InChIKey | KZYHCMQDLKFPQI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|