C11H10F3N3OS — CID 115391102
4-(2-methoxyethyl)-3-(3,4,5-trifluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 115391102) has the molecular formula C11H10F3N3OS and a molecular weight of 289.28 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-3-(3,4,5-trifluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methoxyethyl)-3-(3,4,5-trifluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115391102 |
| Molecular Formula | C11H10F3N3OS |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-(2-methoxyethyl)-3-(3,4,5-trifluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COCCn1c(-c2cc(F)c(F)c(F)c2)n[nH]c1=S |
| InChI | InChI=1S/C11H10F3N3OS/c1-18-3-2-17-10(15-16-11(17)19)6-4-7(12)9(14)8(13)5-6/h4-5H,2-3H2,1H3,(H,16,19) |
| InChIKey | IJSYRWKMJZPXDO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|