C9H11N5O2S — CID 82442056
3-[4-(2-methoxyethyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-1H-pyridazin-6-one (PubChem CID 82442056) has the molecular formula C9H11N5O2S and a molecular weight of 253.29 g/mol. Its IUPAC name is 3-[4-(2-methoxyethyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-1H-pyridazin-6-one.
| Compound Name | 3-[4-(2-methoxyethyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 82442056 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3-[4-(2-methoxyethyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]-1H-pyridazin-6-one |
| SMILES | COCCn1c(-c2ccc(=O)[nH]n2)n[nH]c1=S |
| InChI | InChI=1S/C9H11N5O2S/c1-16-5-4-14-8(12-13-9(14)17)6-2-3-7(15)11-10-6/h2-3H,4-5H2,1H3,(H,11,15)(H,13,17) |
| InChIKey | ZVCGJFYZVIXRND-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|