C6H9N3OS — CID 115390265
4-cyclopropyl-3-methoxy-1H-1,2,4-triazole-5-thione (PubChem CID 115390265) has the molecular formula C6H9N3OS and a molecular weight of 171.22 g/mol. Its IUPAC name is 4-cyclopropyl-3-methoxy-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclopropyl-3-methoxy-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115390265 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-cyclopropyl-3-methoxy-1H-1,2,4-triazole-5-thione |
| SMILES | COc1n[nH]c(=S)n1C1CC1 |
| InChI | InChI=1S/C6H9N3OS/c1-10-5-7-8-6(11)9(5)4-2-3-4/h4H,2-3H2,1H3,(H,8,11) |
| InChIKey | CDGPAODRGBNXQM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|