C15H19N3O2S — CID 115391738
2-[(5-pentan-3-yl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (PubChem CID 115391738) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-[(5-pentan-3-yl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(5-pentan-3-yl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 115391738 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[(5-pentan-3-yl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| SMILES | CCC(CC)c1nnc(SCC(=O)O)n1-c1ccccc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-3-11(4-2)14-16-17-15(21-10-13(19)20)18(14)12-8-6-5-7-9-12/h5-9,11H,3-4,10H2,1-2H3,(H,19,20) |
| InChIKey | QPCWYUBBZGLUGI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |