About 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole
4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole (PubChem CID 115393954) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole.
Analyze 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole?
The IUPAC name of 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole (CID 115393954) is 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole.
What is the SMILES notation for 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole?
The canonical SMILES for 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole is CC(C)n1cnnc1CC(C)C(C)(C)C.
What is the InChIKey of 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole?
The InChIKey is RIWPXNMKXNFQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3/c1-9(2)15-8-13-14-11(15)7-10(3)12(4,5)6/h8-10H,7H2,1-6H3.
What are the key properties of 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole?
4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole has a molecular weight of 209.34 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-3-(2,3,3-trimethylbutyl)-1,2,4-triazole is sourced from PubChem (CID 115393954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).