About 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine
1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine (PubChem CID 62696425) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine.
Analyze 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine?
The IUPAC name of 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine (CID 62696425) is 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine.
What is the SMILES notation for 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine?
The canonical SMILES for 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine is CC(N)Cc1nncn1C(C)C.
What is the InChIKey of 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine?
The InChIKey is GKSLXOUCEMMARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-6(2)12-5-10-11-8(12)4-7(3)9/h5-7H,4,9H2,1-3H3.
What are the key properties of 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine?
1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine has a molecular weight of 168.24 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-propan-2-yl-1,2,4-triazol-3-yl)propan-2-amine is sourced from PubChem (CID 62696425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).