C9H14F3N3 — CID 115394430
4-tert-butyl-3-(3,3,3-trifluoropropyl)-1,2,4-triazole (PubChem CID 115394430) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is 4-tert-butyl-3-(3,3,3-trifluoropropyl)-1,2,4-triazole.
| Compound Name | 4-tert-butyl-3-(3,3,3-trifluoropropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115394430 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 4-tert-butyl-3-(3,3,3-trifluoropropyl)-1,2,4-triazole |
| SMILES | CC(C)(C)n1cnnc1CCC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3/c1-8(2,3)15-6-13-14-7(15)4-5-9(10,11)12/h6H,4-5H2,1-3H3 |
| InChIKey | WTVKXQKQVVHZGT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |