C15H16N4 — CID 115395568
2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]quinoline (PubChem CID 115395568) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]quinoline.
| Compound Name | 2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]quinoline |
|---|---|
| PubChem CID | 115395568 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[4-(2-methylpropyl)-1,2,4-triazol-3-yl]quinoline |
| SMILES | CC(C)Cn1cnnc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H16N4/c1-11(2)9-19-10-16-18-15(19)14-8-7-12-5-3-4-6-13(12)17-14/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | PMIZSEVRQMELFS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |