C17H12N4 — CID 115393314
2-(4-phenyl-1,2,4-triazol-3-yl)quinoline (PubChem CID 115393314) has the molecular formula C17H12N4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-(4-phenyl-1,2,4-triazol-3-yl)quinoline.
| Compound Name | 2-(4-phenyl-1,2,4-triazol-3-yl)quinoline |
|---|---|
| PubChem CID | 115393314 |
| Molecular Formula | C17H12N4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-(4-phenyl-1,2,4-triazol-3-yl)quinoline |
| SMILES | c1ccc(-n2cnnc2-c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C17H12N4/c1-2-7-14(8-3-1)21-12-18-20-17(21)16-11-10-13-6-4-5-9-15(13)19-16/h1-12H |
| InChIKey | LPZWLQHHKUHBDF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |