C22H17N5O2S2 — CID 11539619
4-[[4-[5-[2-(4-aminophenyl)ethynyl]thiophen-2-yl]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 11539619) has the molecular formula C22H17N5O2S2 and a molecular weight of 447.55 g/mol. Its IUPAC name is 4-[[4-[5-[2-(4-aminophenyl)ethynyl]thiophen-2-yl]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-[5-[2-(4-aminophenyl)ethynyl]thiophen-2-yl]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 11539619 |
| Molecular Formula | C22H17N5O2S2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 4-[[4-[5-[2-(4-aminophenyl)ethynyl]thiophen-2-yl]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | Nc1ccc(C#Cc2ccc(-c3ccnc(Nc4ccc(S(N)(=O)=O)cc4)n3)s2)cc1 |
| InChI | InChI=1S/C22H17N5O2S2/c23-16-4-1-15(2-5-16)3-8-18-9-12-21(30-18)20-13-14-25-22(27-20)26-17-6-10-19(11-7-17)31(24,28)29/h1-2,4-7,9-14H,23H2,(H2,24,28,29)(H,25,26,27) |
| InChIKey | QGWYQIDWYUWMQX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|