C11H9ClF3N3 — CID 115397266
3-(chloromethyl)-4-phenyl-5-(2,2,2-trifluoroethyl)-1,2,4-triazole (PubChem CID 115397266) has the molecular formula C11H9ClF3N3 and a molecular weight of 275.66 g/mol. Its IUPAC name is 3-(chloromethyl)-4-phenyl-5-(2,2,2-trifluoroethyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-phenyl-5-(2,2,2-trifluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115397266 |
| Molecular Formula | C11H9ClF3N3 |
| Molecular Weight | 275.66 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 3-(chloromethyl)-4-phenyl-5-(2,2,2-trifluoroethyl)-1,2,4-triazole |
| SMILES | FC(F)(F)Cc1nnc(CCl)n1-c1ccccc1 |
| InChI | InChI=1S/C11H9ClF3N3/c12-7-10-17-16-9(6-11(13,14)15)18(10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | VSCQJIUAPUQEOS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|