C17H16ClN3 — CID 83968299
3-(chloromethyl)-4-phenyl-5-(2-phenylethyl)-1,2,4-triazole (PubChem CID 83968299) has the molecular formula C17H16ClN3 and a molecular weight of 297.79 g/mol. Its IUPAC name is 3-(chloromethyl)-4-phenyl-5-(2-phenylethyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-phenyl-5-(2-phenylethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 83968299 |
| Molecular Formula | C17H16ClN3 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-(chloromethyl)-4-phenyl-5-(2-phenylethyl)-1,2,4-triazole |
| SMILES | ClCc1nnc(CCc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C17H16ClN3/c18-13-17-20-19-16(12-11-14-7-3-1-4-8-14)21(17)15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | NPAHMPUZQDHIDC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|