C8H12ClN3O — CID 115398528
3-(chloromethyl)-4-methyl-5-(oxolan-3-yl)-1,2,4-triazole (PubChem CID 115398528) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is 3-(chloromethyl)-4-methyl-5-(oxolan-3-yl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-methyl-5-(oxolan-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115398528 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 3-(chloromethyl)-4-methyl-5-(oxolan-3-yl)-1,2,4-triazole |
| SMILES | Cn1c(CCl)nnc1C1CCOC1 |
| InChI | InChI=1S/C8H12ClN3O/c1-12-7(4-9)10-11-8(12)6-2-3-13-5-6/h6H,2-5H2,1H3 |
| InChIKey | KKNMQBGBYGOLRX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|