C8H9BrF5N3 — CID 115399123
3-(bromomethyl)-5-(1,1,2,2,2-pentafluoroethyl)-4-propan-2-yl-1,2,4-triazole (PubChem CID 115399123) has the molecular formula C8H9BrF5N3 and a molecular weight of 322.08 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(1,1,2,2,2-pentafluoroethyl)-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-(1,1,2,2,2-pentafluoroethyl)-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 115399123 |
| Molecular Formula | C8H9BrF5N3 |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 3-(bromomethyl)-5-(1,1,2,2,2-pentafluoroethyl)-4-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1c(CBr)nnc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9BrF5N3/c1-4(2)17-5(3-9)15-16-6(17)7(10,11)8(12,13)14/h4H,3H2,1-2H3 |
| InChIKey | ZYZQPGZWPXLEKV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|