C8H8BrF4N3 — CID 115399275
3-(bromomethyl)-4-cyclopropyl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-triazole (PubChem CID 115399275) has the molecular formula C8H8BrF4N3 and a molecular weight of 302.07 g/mol. Its IUPAC name is 3-(bromomethyl)-4-cyclopropyl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-4-cyclopropyl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115399275 |
| Molecular Formula | C8H8BrF4N3 |
| Molecular Weight | 302.07 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 3-(bromomethyl)-4-cyclopropyl-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-triazole |
| SMILES | FC(F)C(F)(F)c1nnc(CBr)n1C1CC1 |
| InChI | InChI=1S/C8H8BrF4N3/c9-3-5-14-15-7(8(12,13)6(10)11)16(5)4-1-2-4/h4,6H,1-3H2 |
| InChIKey | UERYSIFVCCFFSI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.07 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|