C25H31F3N2O3 — CID 11539947
[4-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 11539947) has the molecular formula C25H31F3N2O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is [4-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 11539947 |
| Molecular Formula | C25H31F3N2O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [4-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | COCCOc1ccc(C(C)N2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)c(C)c1C |
| InChI | InChI=1S/C25H31F3N2O3/c1-17-18(2)23(33-16-15-32-4)10-9-22(17)19(3)29-11-13-30(14-12-29)24(31)20-5-7-21(8-6-20)25(26,27)28/h5-10,19H,11-16H2,1-4H3 |
| InChIKey | GJCVORSBBKHQHN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|