C13H10BrN3S — CID 115404681
6-bromo-2-(4-methylsulfanylphenyl)imidazo[1,2-a]pyrimidine (PubChem CID 115404681) has the molecular formula C13H10BrN3S and a molecular weight of 320.22 g/mol. Its IUPAC name is 6-bromo-2-(4-methylsulfanylphenyl)imidazo[1,2-a]pyrimidine.
| Compound Name | 6-bromo-2-(4-methylsulfanylphenyl)imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 115404681 |
| Molecular Formula | C13H10BrN3S |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 6-bromo-2-(4-methylsulfanylphenyl)imidazo[1,2-a]pyrimidine |
| SMILES | CSc1ccc(-c2cn3cc(Br)cnc3n2)cc1 |
| InChI | InChI=1S/C13H10BrN3S/c1-18-11-4-2-9(3-5-11)12-8-17-7-10(14)6-15-13(17)16-12/h2-8H,1H3 |
| InChIKey | RQTRGUMZMORZSL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |