C13H12N2O2 — CID 115404785
8-methoxy-2-(5-methylfuran-2-yl)imidazo[1,2-a]pyridine (PubChem CID 115404785) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 8-methoxy-2-(5-methylfuran-2-yl)imidazo[1,2-a]pyridine.
| Compound Name | 8-methoxy-2-(5-methylfuran-2-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 115404785 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 8-methoxy-2-(5-methylfuran-2-yl)imidazo[1,2-a]pyridine |
| SMILES | COc1cccn2cc(-c3ccc(C)o3)nc12 |
| InChI | InChI=1S/C13H12N2O2/c1-9-5-6-11(17-9)10-8-15-7-3-4-12(16-2)13(15)14-10/h3-8H,1-2H3 |
| InChIKey | KJRHECDTVXIUFV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |