C28H28F3N3O2 — CID 11540517
1-[4-[3-(diethylamino)propoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 11540517) has the molecular formula C28H28F3N3O2 and a molecular weight of 495.55 g/mol. Its IUPAC name is 1-[4-[3-(diethylamino)propoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-[4-[3-(diethylamino)propoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 11540517 |
| Molecular Formula | C28H28F3N3O2 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-[4-[3-(diethylamino)propoxy]phenyl]-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | CCN(CC)CCCOc1ccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H28F3N3O2/c1-3-33(4-2)17-8-18-36-23-15-13-22(14-16-23)34-25-12-6-5-11-24(25)26(27(34)35)32-21-10-7-9-20(19-21)28(29,30)31/h5-7,9-16,19H,3-4,8,17-18H2,1-2H3/b32-26+ |
| InChIKey | KDXOPJLFWJBVTG-HMZBKAONSA-N |
| XLogP | 6.62 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|