C10H11F2NO5S — CID 115405527
5-(2,2-difluoroethylsulfamoyl)-2-hydroxy-4-methylbenzoic acid (PubChem CID 115405527) has the molecular formula C10H11F2NO5S and a molecular weight of 295.26 g/mol. Its IUPAC name is 5-(2,2-difluoroethylsulfamoyl)-2-hydroxy-4-methylbenzoic acid.
| Compound Name | 5-(2,2-difluoroethylsulfamoyl)-2-hydroxy-4-methylbenzoic acid |
|---|---|
| PubChem CID | 115405527 |
| Molecular Formula | C10H11F2NO5S |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-(2,2-difluoroethylsulfamoyl)-2-hydroxy-4-methylbenzoic acid |
| SMILES | Cc1cc(O)c(C(=O)O)cc1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C10H11F2NO5S/c1-5-2-7(14)6(10(15)16)3-8(5)19(17,18)13-4-9(11)12/h2-3,9,13-14H,4H2,1H3,(H,15,16) |
| InChIKey | YHPCOIFZXLVPRT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |