C11H17F2N — CID 115405890
N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2,2-difluoroethanamine (PubChem CID 115405890) has the molecular formula C11H17F2N and a molecular weight of 201.26 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2,2-difluoroethanamine.
| Compound Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 115405890 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2,2-difluoroethanamine |
| SMILES | CC(NCC(F)F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C11H17F2N/c1-7(14-6-11(12)13)10-5-8-2-3-9(10)4-8/h2-3,7-11,14H,4-6H2,1H3 |
| InChIKey | OYGPYEHXXYASDQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|