C8H14F2N2O — CID 115406934
(3S)-N-(2,2-difluoroethyl)piperidine-3-carboxamide (PubChem CID 115406934) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is (3S)-N-(2,2-difluoroethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2,2-difluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 115406934 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (3S)-N-(2,2-difluoroethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(F)F)[C@H]1CCCNC1 |
| InChI | InChI=1S/C8H14F2N2O/c9-7(10)5-12-8(13)6-2-1-3-11-4-6/h6-7,11H,1-5H2,(H,12,13)/t6-/m0/s1 |
| InChIKey | QUGHBOASUQYNRB-LURJTMIESA-N |
| XLogP | 0.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |