C5H8F2N4 — CID 115406987
2,2-difluoro-N-(2H-triazol-4-ylmethyl)ethanamine (PubChem CID 115406987) has the molecular formula C5H8F2N4 and a molecular weight of 162.14 g/mol. Its IUPAC name is 2,2-difluoro-N-(2H-triazol-4-ylmethyl)ethanamine.
| Compound Name | 2,2-difluoro-N-(2H-triazol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115406987 |
| Molecular Formula | C5H8F2N4 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2,2-difluoro-N-(2H-triazol-4-ylmethyl)ethanamine |
| SMILES | FC(F)CNCc1cn[nH]n1 |
| InChI | InChI=1S/C5H8F2N4/c6-5(7)3-8-1-4-2-9-11-10-4/h2,5,8H,1,3H2,(H,9,10,11) |
| InChIKey | XGOUDJHTDPEDGX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |