C7H16F2N2O — CID 115407398
1-N-(2,2-difluoroethyl)-4-methoxybutane-1,2-diamine (PubChem CID 115407398) has the molecular formula C7H16F2N2O and a molecular weight of 182.21 g/mol. Its IUPAC name is 1-N-(2,2-difluoroethyl)-4-methoxybutane-1,2-diamine.
| Compound Name | 1-N-(2,2-difluoroethyl)-4-methoxybutane-1,2-diamine |
|---|---|
| PubChem CID | 115407398 |
| Molecular Formula | C7H16F2N2O |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-N-(2,2-difluoroethyl)-4-methoxybutane-1,2-diamine |
| SMILES | COCCC(N)CNCC(F)F |
| InChI | InChI=1S/C7H16F2N2O/c1-12-3-2-6(10)4-11-5-7(8)9/h6-7,11H,2-5,10H2,1H3 |
| InChIKey | RWFKWOFBHDURGU-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |