C13H13N3O4S — CID 115412042
4-methoxy-2-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]benzoic acid (PubChem CID 115412042) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-methoxy-2-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]benzoic acid.
| Compound Name | 4-methoxy-2-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 115412042 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 4-methoxy-2-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]benzoic acid |
| SMILES | COc1ccc(C(=O)O)c(NC(=O)Nc2nc(C)cs2)c1 |
| InChI | InChI=1S/C13H13N3O4S/c1-7-6-21-13(14-7)16-12(19)15-10-5-8(20-2)3-4-9(10)11(17)18/h3-6H,1-2H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | HAZCGGOXMXLYDL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |