C33H34N6O2 — CID 11541211
4-tert-butyl-N-[3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide (PubChem CID 11541211) has the molecular formula C33H34N6O2 and a molecular weight of 546.68 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 11541211 |
| Molecular Formula | C33H34N6O2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 4-tert-butyl-N-[3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(-c3cn4ccnc4c(Nc4ccc(N5CCOCC5)cc4)n3)c2)cc1 |
| InChI | InChI=1S/C33H34N6O2/c1-33(2,3)25-9-7-23(8-10-25)32(40)36-27-6-4-5-24(21-27)29-22-39-16-15-34-31(39)30(37-29)35-26-11-13-28(14-12-26)38-17-19-41-20-18-38/h4-16,21-22H,17-20H2,1-3H3,(H,35,37)(H,36,40) |
| InChIKey | WGJVRTFZEOAXPF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|