C34H37N7O — CID 59754738
4-tert-butyl-N-[3-[8-[4-[(3R)-3-methylpiperazin-1-yl]anilino]imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide (PubChem CID 59754738) has the molecular formula C34H37N7O and a molecular weight of 559.72 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[8-[4-[(3R)-3-methylpiperazin-1-yl]anilino]imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[8-[4-[(3R)-3-methylpiperazin-1-yl]anilino]imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 59754738 |
| Molecular Formula | C34H37N7O |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 4-tert-butyl-N-[3-[8-[4-[(3R)-3-methylpiperazin-1-yl]anilino]imidazo[1,2-a]pyrazin-6-yl]phenyl]benzamide |
| SMILES | C[C@@H]1CN(c2ccc(Nc3nc(-c4cccc(NC(=O)c5ccc(C(C)(C)C)cc5)c4)cn4ccnc34)cc2)CCN1 |
| InChI | InChI=1S/C34H37N7O/c1-23-21-40(18-16-35-23)29-14-12-27(13-15-29)37-31-32-36-17-19-41(32)22-30(39-31)25-6-5-7-28(20-25)38-33(42)24-8-10-26(11-9-24)34(2,3)4/h5-15,17,19-20,22-23,35H,16,18,21H2,1-4H3,(H,37,39)(H,38,42)/t23-/m1/s1 |
| InChIKey | SGCOACUWSLIJQP-HSZRJFAPSA-N |
| XLogP | 6.49 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|