C12H16N2O6S — CID 115412131
5-methoxy-2-(2-methylsulfonylethylcarbamoylamino)benzoic acid (PubChem CID 115412131) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is 5-methoxy-2-(2-methylsulfonylethylcarbamoylamino)benzoic acid.
| Compound Name | 5-methoxy-2-(2-methylsulfonylethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 115412131 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 5-methoxy-2-(2-methylsulfonylethylcarbamoylamino)benzoic acid |
| SMILES | COc1ccc(NC(=O)NCCS(C)(=O)=O)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H16N2O6S/c1-20-8-3-4-10(9(7-8)11(15)16)14-12(17)13-5-6-21(2,18)19/h3-4,7H,5-6H2,1-2H3,(H,15,16)(H2,13,14,17) |
| InChIKey | ASKGGRCYXSKGDK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |