C15H18N2O4 — CID 115412194
2-(2-azabicyclo[2.2.1]heptane-2-carbonylamino)-4-methoxybenzoic acid (PubChem CID 115412194) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(2-azabicyclo[2.2.1]heptane-2-carbonylamino)-4-methoxybenzoic acid.
| Compound Name | 2-(2-azabicyclo[2.2.1]heptane-2-carbonylamino)-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 115412194 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-(2-azabicyclo[2.2.1]heptane-2-carbonylamino)-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)c(NC(=O)N2CC3CCC2C3)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-21-11-4-5-12(14(18)19)13(7-11)16-15(20)17-8-9-2-3-10(17)6-9/h4-5,7,9-10H,2-3,6,8H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | OREXBWIZNCBVBW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |