C8H14N2O2 — CID 130614903
N-methoxy-2-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 130614903) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is N-methoxy-2-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-methoxy-2-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 130614903 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | N-methoxy-2-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CONC(=O)N1CC2CCC1C2 |
| InChI | InChI=1S/C8H14N2O2/c1-12-9-8(11)10-5-6-2-3-7(10)4-6/h6-7H,2-5H2,1H3,(H,9,11) |
| InChIKey | KUICCDZNBJCJQC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|