C14H13N3O4 — CID 115413708
5-[(2-amino-5-methoxybenzoyl)amino]pyridine-2-carboxylic acid (PubChem CID 115413708) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 5-[(2-amino-5-methoxybenzoyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 5-[(2-amino-5-methoxybenzoyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 115413708 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 5-[(2-amino-5-methoxybenzoyl)amino]pyridine-2-carboxylic acid |
| SMILES | COc1ccc(N)c(C(=O)Nc2ccc(C(=O)O)nc2)c1 |
| InChI | InChI=1S/C14H13N3O4/c1-21-9-3-4-11(15)10(6-9)13(18)17-8-2-5-12(14(19)20)16-7-8/h2-7H,15H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | JPEZBMPSIFOBBY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|