C16H21N3O2Si — CID 89316590
2-amino-5-methoxy-N-(5-trimethylsilyl-2-pyridinyl)benzamide (PubChem CID 89316590) has the molecular formula C16H21N3O2Si and a molecular weight of 315.45 g/mol. Its IUPAC name is 2-amino-5-methoxy-N-(5-trimethylsilyl-2-pyridinyl)benzamide.
| Compound Name | 2-amino-5-methoxy-N-(5-trimethylsilyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 89316590 |
| Molecular Formula | C16H21N3O2Si |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-amino-5-methoxy-N-(5-trimethylsilyl-2-pyridinyl)benzamide |
| SMILES | COc1ccc(N)c(C(=O)Nc2ccc([Si](C)(C)C)cn2)c1 |
| InChI | InChI=1S/C16H21N3O2Si/c1-21-11-5-7-14(17)13(9-11)16(20)19-15-8-6-12(10-18-15)22(2,3)4/h5-10H,17H2,1-4H3,(H,18,19,20) |
| InChIKey | BGRZLEKYFPQVSX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|