C11H11FN4 — CID 115416985
6-fluoro-N-[(3-methyl-2-pyridinyl)methyl]pyrimidin-4-amine (PubChem CID 115416985) has the molecular formula C11H11FN4 and a molecular weight of 218.24 g/mol. Its IUPAC name is 6-fluoro-N-[(3-methyl-2-pyridinyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-fluoro-N-[(3-methyl-2-pyridinyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 115416985 |
| Molecular Formula | C11H11FN4 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 6-fluoro-N-[(3-methyl-2-pyridinyl)methyl]pyrimidin-4-amine |
| SMILES | Cc1cccnc1CNc1cc(F)ncn1 |
| InChI | InChI=1S/C11H11FN4/c1-8-3-2-4-13-9(8)6-14-11-5-10(12)15-7-16-11/h2-5,7H,6H2,1H3,(H,14,15,16) |
| InChIKey | BIJPYGOGZVVLAL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |