C12H18FN3 — CID 115417100
1-(6-fluoropyrimidin-4-yl)-4,4-dimethylazepane (PubChem CID 115417100) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-(6-fluoropyrimidin-4-yl)-4,4-dimethylazepane.
| Compound Name | 1-(6-fluoropyrimidin-4-yl)-4,4-dimethylazepane |
|---|---|
| PubChem CID | 115417100 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 1-(6-fluoropyrimidin-4-yl)-4,4-dimethylazepane |
| SMILES | CC1(C)CCCN(c2cc(F)ncn2)CC1 |
| InChI | InChI=1S/C12H18FN3/c1-12(2)4-3-6-16(7-5-12)11-8-10(13)14-9-15-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | UTZRSPBFEJUYQN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |